C33H26BNO7 — CID 6666305
[3-[(3aS,6R,11aS,11bR)-6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 6666305) has the molecular formula C33H26BNO7 and a molecular weight of 559.38 g/mol. Its IUPAC name is [3-[(3aS,6R,11aS,11bR)-6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,6R,11aS,11bR)-6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 6666305 |
| Molecular Formula | C33H26BNO7 |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | [3-[(3aS,6R,11aS,11bR)-6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1ccc(O)c3ccccc13)C1=CC[C@@H]3C(=O)N(c4cccc(B(O)O)c4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C33H26BNO7/c1-16-13-27(37)25-15-24-22(28(30(25)31(16)38)21-11-12-26(36)20-8-3-2-7-19(20)21)9-10-23-29(24)33(40)35(32(23)39)18-6-4-5-17(14-18)34(41)42/h2-9,11-14,23-24,28-29,36,41-42H,10,15H2,1H3/t23-,24+,28-,29-/m0/s1 |
| InChIKey | ISSVIVLJTANFSG-YZUKIZEGSA-N |
| XLogP | 2.86 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|