C21H18Br2N2O8 — CID 5045415
6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2,8-dihydroxy-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5045415) has the molecular formula C21H18Br2N2O8 and a molecular weight of 586.19 g/mol. Its IUPAC name is 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2,8-dihydroxy-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2,8-dihydroxy-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5045415 |
| Molecular Formula | C21H18Br2N2O8 |
| Molecular Weight | 586.19 g/mol |
| Exact Mass | 583.94 |
| IUPAC Name | 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2,8-dihydroxy-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(O)C(=O)C32)c(Br)c(Br)c1O |
| InChI | InChI=1S/C21H18Br2N2O8/c1-33-11-5-9(15(22)16(23)17(11)26)12-6-2-3-7-13(20(29)24(31)18(7)27)8(6)4-10-14(12)21(30)25(32)19(10)28/h2,5,7-8,10,12-14,26,31-32H,3-4H2,1H3 |
| InChIKey | XKVFNFVBUIHODH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|