C28H24Br2N2O7 — CID 4088186
6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4088186) has the molecular formula C28H24Br2N2O7 and a molecular weight of 660.32 g/mol. Its IUPAC name is 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4088186 |
| Molecular Formula | C28H24Br2N2O7 |
| Molecular Weight | 660.32 g/mol |
| Exact Mass | 658.00 |
| IUPAC Name | 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c(Br)c(Br)c1O |
| InChI | InChI=1S/C28H24Br2N2O7/c1-28-17(25(35)31(27(28)37)12-6-4-3-5-7-12)10-15-13(8-9-14-19(15)26(36)32(38)24(14)34)20(28)16-11-18(39-2)23(33)22(30)21(16)29/h3-8,11,14-15,17,19-20,33,38H,9-10H2,1-2H3 |
| InChIKey | OGZSZYJCTFCRLH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|