C32H32Br2N2O6 — CID 4668626
2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4668626) has the molecular formula C32H32Br2N2O6 and a molecular weight of 700.42 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4668626 |
| Molecular Formula | C32H32Br2N2O6 |
| Molecular Weight | 700.42 g/mol |
| Exact Mass | 698.06 |
| IUPAC Name | 2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C(C)(C)C)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c(Br)c(Br)c1O |
| InChI | InChI=1S/C32H32Br2N2O6/c1-31(2,3)36-27(38)17-12-11-16-18(22(17)29(36)40)13-20-28(39)35(15-9-7-6-8-10-15)30(41)32(20,4)23(16)19-14-21(42-5)26(37)25(34)24(19)33/h6-11,14,17-18,20,22-23,37H,12-13H2,1-5H3 |
| InChIKey | JZKNQRKHUKCUIL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|