C28H25BrN2O7 — CID 4053013
6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4053013) has the molecular formula C28H25BrN2O7 and a molecular weight of 581.42 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4053013 |
| Molecular Formula | C28H25BrN2O7 |
| Molecular Weight | 581.42 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2-hydroxy-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(Br)cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c1O |
| InChI | InChI=1S/C28H25BrN2O7/c1-28-19(25(34)30(27(28)36)14-6-4-3-5-7-14)12-17-15(8-9-16-21(17)26(35)31(37)24(16)33)22(28)18-10-13(29)11-20(38-2)23(18)32/h3-8,10-11,16-17,19,21-22,32,37H,9,12H2,1-2H3 |
| InChIKey | RMRONTFINMPKHS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|