C34H29BBr2N2O8 — CID 4671978
[3-[6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 4671978) has the molecular formula C34H29BBr2N2O8 and a molecular weight of 764.23 g/mol. Its IUPAC name is [3-[6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 4671978 |
| Molecular Formula | C34H29BBr2N2O8 |
| Molecular Weight | 764.23 g/mol |
| Exact Mass | 762.04 |
| IUPAC Name | [3-[6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c(Br)c(Br)c1O |
| InChI | InChI=1S/C34H29BBr2N2O8/c1-34-23(31(42)39(33(34)44)17-8-4-3-5-9-17)14-21-19(26(34)22-15-24(47-2)29(40)28(37)27(22)36)11-12-20-25(21)32(43)38(30(20)41)18-10-6-7-16(13-18)35(45)46/h3-11,13,15,20-21,23,25-26,40,45-46H,12,14H2,1-2H3 |
| InChIKey | SXFCGFUBLATKAQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|