C47H34Br2N2O8 — CID 4125804
2,8-bis(4-benzoylphenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4125804) has the molecular formula C47H34Br2N2O8 and a molecular weight of 914.60 g/mol. Its IUPAC name is 2,8-bis(4-benzoylphenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-benzoylphenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4125804 |
| Molecular Formula | C47H34Br2N2O8 |
| Molecular Weight | 914.60 g/mol |
| Exact Mass | 912.07 |
| IUPAC Name | 2,8-bis(4-benzoylphenyl)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)C4C3CC3C(=O)N(c4ccc(C(=O)c5ccccc5)cc4)C(=O)C32)c(Br)c(Br)c1O |
| InChI | InChI=1S/C47H34Br2N2O8/c1-59-35-23-33(39(48)40(49)43(35)54)36-30-20-21-31-37(46(57)50(44(31)55)28-16-12-26(13-17-28)41(52)24-8-4-2-5-9-24)32(30)22-34-38(36)47(58)51(45(34)56)29-18-14-27(15-19-29)42(53)25-10-6-3-7-11-25/h2-20,23,31-32,34,36-38,54H,21-22H2,1H3 |
| InChIKey | LZZSMUJHTYMMBT-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.60 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|