C21H19IN2O8 — CID 4227457
2,8-dihydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4227457) has the molecular formula C21H19IN2O8 and a molecular weight of 554.29 g/mol. Its IUPAC name is 2,8-dihydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-dihydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4227457 |
| Molecular Formula | C21H19IN2O8 |
| Molecular Weight | 554.29 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 2,8-dihydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(O)C(=O)C32)cc(I)c1O |
| InChI | InChI=1S/C21H19IN2O8/c1-32-13-5-7(4-12(22)17(13)25)14-8-2-3-9-15(20(28)23(30)18(9)26)10(8)6-11-16(14)21(29)24(31)19(11)27/h2,4-5,9-11,14-16,25,30-31H,3,6H2,1H3 |
| InChIKey | GNIWPVONEKAHKN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|