C27H21Cl2FN2O7 — CID 6644245
(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6644245) has the molecular formula C27H21Cl2FN2O7 and a molecular weight of 575.38 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6644245 |
| Molecular Formula | C27H21Cl2FN2O7 |
| Molecular Weight | 575.38 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(2-hydroxy-6-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cccc(O)c1[C@H]1C2=CC[C@@H]3C(=O)N(O)C(=O)[C@@H]3[C@@H]2C[C@@]2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)[C@@]12Cl |
| InChI | InChI=1S/C27H21Cl2FN2O7/c1-39-18-4-2-3-17(33)20(18)21-14-9-10-15-19(23(35)32(38)22(15)34)16(14)11-26(28)24(36)31(25(37)27(21,26)29)13-7-5-12(30)6-8-13/h2-9,15-16,19,21,33,38H,10-11H2,1H3/t15-,16+,19-,21+,26+,27-/m0/s1 |
| InChIKey | WIASLXYQGVYOEP-LXKIHQMLSA-N |
| XLogP | 3.49 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|