C28H18Cl2F5N3O7 — CID 5107384
6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 5107384) has the molecular formula C28H18Cl2F5N3O7 and a molecular weight of 674.36 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 5107384 |
| Molecular Formula | C28H18Cl2F5N3O7 |
| Molecular Weight | 674.36 g/mol |
| Exact Mass | 673.04 |
| IUPAC Name | 6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(C(N)=O)C(=O)C3C2CC2(Cl)C(=O)N(c3c(F)c(F)c(F)c(F)c3F)C(=O)C12Cl |
| InChI | InChI=1S/C28H18Cl2F5N3O7/c1-45-12-4-2-3-11(39)14(12)15-8-5-6-9-13(23(41)38(22(9)40)26(36)44)10(8)7-27(29)24(42)37(25(43)28(15,27)30)21-19(34)17(32)16(31)18(33)20(21)35/h2-5,9-10,13,15,39H,6-7H2,1H3,(H2,36,44) |
| InChIKey | TZCZTHVIYIDVMU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|