C34H34BrCl2N3O6 — CID 4133123
2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4133123) has the molecular formula C34H34BrCl2N3O6 and a molecular weight of 731.47 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4133123 |
| Molecular Formula | C34H34BrCl2N3O6 |
| Molecular Weight | 731.47 g/mol |
| Exact Mass | 729.10 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(O)c(C2C3=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)c1 |
| InChI | InChI=1S/C34H34BrCl2N3O6/c1-46-21-7-10-26(41)24(15-21)28-22-8-9-23-27(25(22)16-33(36)31(44)39(18-35)32(45)34(28,33)37)30(43)40(29(23)42)20-11-13-38(14-12-20)17-19-5-3-2-4-6-19/h2-8,10,15,20,23,25,27-28,41H,9,11-14,16-18H2,1H3 |
| InChIKey | JTEIZPDSMNAIDI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|