C35H36BrCl2N3O6 — CID 5067124
2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5067124) has the molecular formula C35H36BrCl2N3O6 and a molecular weight of 745.50 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5067124 |
| Molecular Formula | C35H36BrCl2N3O6 |
| Molecular Weight | 745.50 g/mol |
| Exact Mass | 743.12 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3ccccc3OCCO)C2C(=O)N1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C35H36BrCl2N3O6/c36-20-40-32(45)34(37)18-26-23(29(35(34,38)33(40)46)24-8-4-5-9-27(24)47-17-16-42)10-11-25-28(26)31(44)41(30(25)43)22-12-14-39(15-13-22)19-21-6-2-1-3-7-21/h1-10,22,25-26,28-29,42H,11-20H2 |
| InChIKey | NSSGWKSDYGUSSP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|