C43H48N4O6 — CID 4133629
2,8-bis(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4133629) has the molecular formula C43H48N4O6 and a molecular weight of 716.88 g/mol. Its IUPAC name is 2,8-bis(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4133629 |
| Molecular Formula | C43H48N4O6 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | 2,8-bis(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C4C3c3ccc(CO)o3)C2C(=O)N1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C43H48N4O6/c48-26-31-11-14-36(53-31)38-32-12-13-33-37(42(51)46(40(33)49)29-15-19-44(20-16-29)24-27-7-3-1-4-8-27)34(32)23-35-39(38)43(52)47(41(35)50)30-17-21-45(22-18-30)25-28-9-5-2-6-10-28/h1-12,14,29-30,33-35,37-39,48H,13,15-26H2 |
| InChIKey | KQSDBVNGXADRCX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|