C45H49ClN4O6 — CID 5065384
2,8-bis(1-benzylpiperidin-4-yl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5065384) has the molecular formula C45H49ClN4O6 and a molecular weight of 777.36 g/mol. Its IUPAC name is 2,8-bis(1-benzylpiperidin-4-yl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(1-benzylpiperidin-4-yl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5065384 |
| Molecular Formula | C45H49ClN4O6 |
| Molecular Weight | 777.36 g/mol |
| Exact Mass | 776.33 |
| IUPAC Name | 2,8-bis(1-benzylpiperidin-4-yl)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C4C3CC3C(=O)N(C4CCN(Cc5ccccc5)CC4)C(=O)C32)cc(Cl)c1O |
| InChI | InChI=1S/C45H49ClN4O6/c1-56-37-23-29(22-36(46)41(37)51)38-32-12-13-33-39(44(54)49(42(33)52)30-14-18-47(19-15-30)25-27-8-4-2-5-9-27)34(32)24-35-40(38)45(55)50(43(35)53)31-16-20-48(21-17-31)26-28-10-6-3-7-11-28/h2-12,22-23,30-31,33-35,38-40,51H,13-21,24-26H2,1H3 |
| InChIKey | COTWBNJMRBZXIE-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.36 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|