C43H45N3O7 — CID 5068167
2-(1-benzylpiperidin-4-yl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5068167) has the molecular formula C43H45N3O7 and a molecular weight of 715.85 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5068167 |
| Molecular Formula | C43H45N3O7 |
| Molecular Weight | 715.85 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C23C)cc(OC)c1O |
| InChI | InChI=1S/C43H45N3O7/c1-43-33(17-14-27-22-35(52-2)38(47)36(23-27)53-3)30-15-16-31-37(32(30)24-34(43)40(49)46(42(43)51)28-12-8-5-9-13-28)41(50)45(39(31)48)29-18-20-44(21-19-29)25-26-10-6-4-7-11-26/h4-15,17,22-23,29,31-34,37,47H,16,18-21,24-25H2,1-3H3 |
| InChIKey | SEZWSPLSSADKSJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.85 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|