C19H18N2O8 — CID 5000947
2,8-dihydroxy-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5000947) has the molecular formula C19H18N2O8 and a molecular weight of 402.36 g/mol. Its IUPAC name is 2,8-dihydroxy-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-dihydroxy-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5000947 |
| Molecular Formula | C19H18N2O8 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2,8-dihydroxy-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(O)C(=O)C4C3c3ccc(CO)o3)C2C(=O)N1O |
| InChI | InChI=1S/C19H18N2O8/c22-6-7-1-4-12(29-7)14-8-2-3-9-13(18(25)20(27)16(9)23)10(8)5-11-15(14)19(26)21(28)17(11)24/h1-2,4,9-11,13-15,22,27-28H,3,5-6H2 |
| InChIKey | LVCSDGXDAOXDCW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|