C34H32N2O7 — CID 5103281
6-[5-(hydroxymethyl)furan-2-yl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5103281) has the molecular formula C34H32N2O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is 6-[5-(hydroxymethyl)furan-2-yl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-[5-(hydroxymethyl)furan-2-yl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5103281 |
| Molecular Formula | C34H32N2O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 6-[5-(hydroxymethyl)furan-2-yl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccccc3)C(=O)C1CC1C(=CCC3C(=O)N(CCc4ccc(O)cc4)C(=O)C31)C2c1ccc(CO)o1 |
| InChI | InChI=1S/C34H32N2O7/c1-34-26(31(40)36(33(34)42)20-5-3-2-4-6-20)17-25-23(29(34)27-14-11-22(18-37)43-27)12-13-24-28(25)32(41)35(30(24)39)16-15-19-7-9-21(38)10-8-19/h2-12,14,24-26,28-29,37-38H,13,15-18H2,1H3 |
| InChIKey | PZPCYHOGDXNLQH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|