C37H40N2O5 — CID 6666642
(3aS,6S,6aS,10aR,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(4-hydroxyphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666642) has the molecular formula C37H40N2O5 and a molecular weight of 592.74 g/mol. Its IUPAC name is (3aS,6S,6aS,10aR,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(4-hydroxyphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,6aS,10aR,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(4-hydroxyphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666642 |
| Molecular Formula | C37H40N2O5 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | (3aS,6S,6aS,10aR,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(4-hydroxyphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3ccc(O)cc3)C3=CC[C@@H]4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)[C@@H]4[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C37H40N2O5/c1-21-22(2)34(42)37(3)30(33(21)41)19-29-27(32(37)24-9-11-26(40)12-10-24)13-14-28-31(29)36(44)39(35(28)43)25-15-17-38(18-16-25)20-23-7-5-4-6-8-23/h4-13,25,28-32,40H,14-20H2,1-3H3/t28-,29+,30-,31-,32-,37+/m0/s1 |
| InChIKey | VNXHIRVBAPBBMM-RZLJCCINSA-N |
| XLogP | 5.20 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|