C33H39NO5 — CID 6666714
(3aS,6R,6aS,10aR,11aS,11bR)-2-cyclohexyl-6-(4-hydroxy-3,5-dimethylphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666714) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-2-cyclohexyl-6-(4-hydroxy-3,5-dimethylphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-cyclohexyl-6-(4-hydroxy-3,5-dimethylphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666714 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-cyclohexyl-6-(4-hydroxy-3,5-dimethylphenyl)-6a,8,9-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3cc(C)c(O)c(C)c3)C3=CC[C@@H]4C(=O)N(C5CCCCC5)C(=O)[C@@H]4[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C33H39NO5/c1-16-13-20(14-17(2)28(16)35)27-22-11-12-23-26(32(39)34(31(23)38)21-9-7-6-8-10-21)24(22)15-25-29(36)18(3)19(4)30(37)33(25,27)5/h11,13-14,21,23-27,35H,6-10,12,15H2,1-5H3/t23-,24+,25-,26-,27-,33+/m0/s1 |
| InChIKey | XFANPHIXSCLVQO-VLPZUJLISA-N |
| XLogP | 5.49 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|