C28H31NO6 — CID 6666745
(3aS,6S,6aS,10aR,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-2,6a,8,9-tetramethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666745) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is (3aS,6S,6aS,10aR,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-2,6a,8,9-tetramethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,6aS,10aR,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-2,6a,8,9-tetramethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666745 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (3aS,6S,6aS,10aR,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-2,6a,8,9-tetramethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3ccc(OCCO)cc3)C3=CC[C@@H]4C(=O)N(C)C(=O)[C@@H]4[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C28H31NO6/c1-14-15(2)25(32)28(3)21(24(14)31)13-20-18(9-10-19-22(20)27(34)29(4)26(19)33)23(28)16-5-7-17(8-6-16)35-12-11-30/h5-9,19-23,30H,10-13H2,1-4H3/t19-,20+,21-,22-,23-,28+/m0/s1 |
| InChIKey | NIEGBOAGYZRMNN-ADMXZPSNSA-N |
| XLogP | 2.83 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|