C34H36N2O5 — CID 6656856
(3aS,6R,6aS,9aR,10aS,10bR)-2-cyclohexyl-6-(2-hydroxy-3-methylphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6656856) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-2-cyclohexyl-6-(2-hydroxy-3-methylphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-cyclohexyl-6-(2-hydroxy-3-methylphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6656856 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-cyclohexyl-6-(2-hydroxy-3-methylphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cccc([C@H]2C3=CC[C@@H]4C(=O)N(C5CCCCC5)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)N(c4ccccc4)C(=O)[C@@]23C)c1O |
| InChI | InChI=1S/C34H36N2O5/c1-19-10-9-15-24(29(19)37)28-22-16-17-23-27(32(40)35(30(23)38)20-11-5-3-6-12-20)25(22)18-26-31(39)36(33(41)34(26,28)2)21-13-7-4-8-14-21/h4,7-10,13-16,20,23,25-28,37H,3,5-6,11-12,17-18H2,1-2H3/t23-,25+,26-,27-,28+,34+/m0/s1 |
| InChIKey | GDQPYWJSHDSHKT-MWUCMGIXSA-N |
| XLogP | 5.26 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|