C33H31Cl2FN2O5 — CID 4047785
6a,9a-dichloro-2-cyclohexyl-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4047785) has the molecular formula C33H31Cl2FN2O5 and a molecular weight of 625.52 g/mol. Its IUPAC name is 6a,9a-dichloro-2-cyclohexyl-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-cyclohexyl-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4047785 |
| Molecular Formula | C33H31Cl2FN2O5 |
| Molecular Weight | 625.52 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 6a,9a-dichloro-2-cyclohexyl-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C33H31Cl2FN2O5/c1-17-6-5-9-23(27(17)39)26-21-14-15-22-25(29(41)37(28(22)40)19-7-3-2-4-8-19)24(21)16-32(34)30(42)38(31(43)33(26,32)35)20-12-10-18(36)11-13-20/h5-6,9-14,19,22,24-26,39H,2-4,7-8,15-16H2,1H3 |
| InChIKey | ZDUWZICDXRZXQU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|