C32H25Cl2FN2O5S — CID 5054667
6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5054667) has the molecular formula C32H25Cl2FN2O5S and a molecular weight of 639.53 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5054667 |
| Molecular Formula | C32H25Cl2FN2O5S |
| Molecular Weight | 639.53 g/mol |
| Exact Mass | 638.08 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methylphenyl)-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(Cc5cccs5)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C32H25Cl2FN2O5S/c1-16-4-2-6-22(26(16)38)25-20-11-12-21-24(28(40)36(27(21)39)15-19-5-3-13-43-19)23(20)14-31(33)29(41)37(30(42)32(25,31)34)18-9-7-17(35)8-10-18/h2-11,13,21,23-25,38H,12,14-15H2,1H3 |
| InChIKey | FJEDICJTAUAUKM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|