C44H40ClFN4O5 — CID 4534308
2-(1-benzylpiperidin-4-yl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4534308) has the molecular formula C44H40ClFN4O5 and a molecular weight of 759.28 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4534308 |
| Molecular Formula | C44H40ClFN4O5 |
| Molecular Weight | 759.28 g/mol |
| Exact Mass | 758.27 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC3C(=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C43)C(c3ccc(O)cc3)C2(c2ccc(Cl)cc2)C(=O)N1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C44H40ClFN4O5/c45-29-10-8-28(9-11-29)44-37(41(53)50(43(44)55)47-31-14-12-30(46)13-15-31)24-36-34(39(44)27-6-16-33(51)17-7-27)18-19-35-38(36)42(54)49(40(35)52)32-20-22-48(23-21-32)25-26-4-2-1-3-5-26/h1-18,32,35-39,47,51H,19-25H2 |
| InChIKey | VJAVFQQTEHEQGL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.28 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|