C46H46N4O6 — CID 4220559
2-(1-benzylpiperidin-4-yl)-6-(3-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4220559) has the molecular formula C46H46N4O6 and a molecular weight of 750.90 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6-(3-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6-(3-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4220559 |
| Molecular Formula | C46H46N4O6 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.34 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6-(3-hydroxy-4-methoxyphenyl)-8-(4-methylanilino)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)cc1O |
| InChI | InChI=1S/C46H46N4O6/c1-28-13-16-32(17-14-28)47-50-43(53)37-26-36-34(41(30-15-20-39(56-2)38(51)25-30)46(37,45(50)55)31-11-7-4-8-12-31)18-19-35-40(36)44(54)49(42(35)52)33-21-23-48(24-22-33)27-29-9-5-3-6-10-29/h3-18,20,25,33,35-37,40-41,47,51H,19,21-24,26-27H2,1-2H3 |
| InChIKey | IUHUWFBAFPBDLF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|