C33H29NO7 — CID 6664225
(3aS,6R,11aS,11bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6664225) has the molecular formula C33H29NO7 and a molecular weight of 551.60 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6664225 |
| Molecular Formula | C33H29NO7 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)[C@H]3[C@H](CC=C4[C@H](c5c(OC)cc(O)cc5OC)C5=C(C[C@H]43)C(=O)C(C)=CC5=O)C2=O)cc1 |
| InChI | InChI=1S/C33H29NO7/c1-5-17-6-8-18(9-7-17)34-32(38)21-11-10-20-22(27(21)33(34)39)15-23-28(24(36)12-16(2)31(23)37)29(20)30-25(40-3)13-19(35)14-26(30)41-4/h5-10,12-14,21-22,27,29,35H,1,11,15H2,2-4H3/t21-,22+,27-,29-/m0/s1 |
| InChIKey | VYTSXYIDTNGEFQ-GDCVQUFQSA-N |
| XLogP | 4.69 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|