C29H21FN2O7 — CID 4153522
6-(3-fluoro-2-hydroxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4153522) has the molecular formula C29H21FN2O7 and a molecular weight of 528.49 g/mol. Its IUPAC name is 6-(3-fluoro-2-hydroxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(3-fluoro-2-hydroxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4153522 |
| Molecular Formula | C29H21FN2O7 |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 6-(3-fluoro-2-hydroxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)C(c1cccc(F)c1O)C1=CCC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C3C1C2 |
| InChI | InChI=1S/C29H21FN2O7/c1-13-11-22(33)20-12-19-16(23(25(20)26(13)34)17-3-2-4-21(30)27(17)35)9-10-18-24(19)29(37)31(28(18)36)14-5-7-15(8-6-14)32(38)39/h2-9,11,18-19,23-24,35H,10,12H2,1H3 |
| InChIKey | RBQVYRLSFWPLJC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|