C30H23ClFNO5 — CID 4570218
2-(3-chloro-4-methylphenyl)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4570218) has the molecular formula C30H23ClFNO5 and a molecular weight of 531.97 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(3-chloro-4-methylphenyl)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4570218 |
| Molecular Formula | C30H23ClFNO5 |
| Molecular Weight | 531.97 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)C(c1cccc(F)c1O)C1=CCC3C(=O)N(c4ccc(C)c(Cl)c4)C(=O)C3C1C2 |
| InChI | InChI=1S/C30H23ClFNO5/c1-13-6-7-15(11-21(13)31)33-29(37)18-9-8-16-19(25(18)30(33)38)12-20-23(34)10-14(2)27(35)26(20)24(16)17-4-3-5-22(32)28(17)36/h3-8,10-11,18-19,24-25,36H,9,12H2,1-2H3 |
| InChIKey | CUOZYPSHIQYXOW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|