C37H26F3NO7 — CID 6663745
(3aS,6R,11aS,11bR)-2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6663745) has the molecular formula C37H26F3NO7 and a molecular weight of 653.61 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6663745 |
| Molecular Formula | C37H26F3NO7 |
| Molecular Weight | 653.61 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)[C@@H]43)[C@@H]2c2cc(OC(F)(F)F)ccc2O)C1=O |
| InChI | InChI=1S/C37H26F3NO7/c1-18-15-29(43)32-27(33(18)44)17-25-23(30(32)26-16-22(11-14-28(26)42)48-37(38,39)40)12-13-24-31(25)36(47)41(35(24)46)21-9-7-20(8-10-21)34(45)19-5-3-2-4-6-19/h2-12,14-16,24-25,30-31,42H,13,17H2,1H3/t24-,25+,30+,31-/m0/s1 |
| InChIKey | MQEWCWQNTDPYMP-AMZZPRKGSA-N |
| XLogP | 6.16 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|