C28H30N2O10 — CID 6637890
3-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(2-carboxyethyl)-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 6637890) has the molecular formula C28H30N2O10 and a molecular weight of 554.55 g/mol. Its IUPAC name is 3-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(2-carboxyethyl)-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(2-carboxyethyl)-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6637890 |
| Molecular Formula | C28H30N2O10 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(2-carboxyethyl)-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | CCOc1cccc([C@H]2C3=CC[C@@H]4C(=O)N(CCC(=O)O)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)N(CCC(=O)O)C(=O)[C@@H]23)c1O |
| InChI | InChI=1S/C28H30N2O10/c1-2-40-18-5-3-4-14(24(18)35)21-13-6-7-15-22(27(38)29(25(15)36)10-8-19(31)32)16(13)12-17-23(21)28(39)30(26(17)37)11-9-20(33)34/h3-6,15-17,21-23,35H,2,7-12H2,1H3,(H,31,32)(H,33,34)/t15-,16+,17+,21+,22-,23+/m0/s1 |
| InChIKey | GOTRQIDURLGLJI-UYMTVXDKSA-N |
| XLogP | 1.38 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|