C32H30N2O6S2 — CID 4223909
6-(3-ethoxy-2-hydroxyphenyl)-2,8-bis(thiophen-2-ylmethyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4223909) has the molecular formula C32H30N2O6S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is 6-(3-ethoxy-2-hydroxyphenyl)-2,8-bis(thiophen-2-ylmethyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(3-ethoxy-2-hydroxyphenyl)-2,8-bis(thiophen-2-ylmethyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4223909 |
| Molecular Formula | C32H30N2O6S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 6-(3-ethoxy-2-hydroxyphenyl)-2,8-bis(thiophen-2-ylmethyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(Cc5cccs5)C(=O)C4C3CC3C(=O)N(Cc4cccs4)C(=O)C32)c1O |
| InChI | InChI=1S/C32H30N2O6S2/c1-2-40-24-9-3-8-20(28(24)35)25-19-10-11-21-26(31(38)33(29(21)36)15-17-6-4-12-41-17)22(19)14-23-27(25)32(39)34(30(23)37)16-18-7-5-13-42-18/h3-10,12-13,21-23,25-27,35H,2,11,14-16H2,1H3 |
| InChIKey | XVDWTCAIAQQXQB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|