C34H28Cl2N2O6 — CID 4570849
2,8-bis(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4570849) has the molecular formula C34H28Cl2N2O6 and a molecular weight of 631.51 g/mol. Its IUPAC name is 2,8-bis(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4570849 |
| Molecular Formula | C34H28Cl2N2O6 |
| Molecular Weight | 631.51 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | 2,8-bis(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(c5ccc(Cl)cc5)C(=O)C4C3CC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)c1O |
| InChI | InChI=1S/C34H28Cl2N2O6/c1-2-44-26-5-3-4-22(30(26)39)27-21-14-15-23-28(33(42)37(31(23)40)19-10-6-17(35)7-11-19)24(21)16-25-29(27)34(43)38(32(25)41)20-12-8-18(36)9-13-20/h3-14,23-25,27-29,39H,2,15-16H2,1H3 |
| InChIKey | YQNZQXHOXWMZOZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|