C38H38N2O6 — CID 6638626
(3aS,6R,6aS,9aR,10aS,10bR)-6-(3-ethoxy-4-hydroxyphenyl)-2,8-bis(4-ethylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6638626) has the molecular formula C38H38N2O6 and a molecular weight of 618.73 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-6-(3-ethoxy-4-hydroxyphenyl)-2,8-bis(4-ethylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-6-(3-ethoxy-4-hydroxyphenyl)-2,8-bis(4-ethylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6638626 |
| Molecular Formula | C38H38N2O6 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-6-(3-ethoxy-4-hydroxyphenyl)-2,8-bis(4-ethylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cc([C@H]2C3=CC[C@@H]4C(=O)N(c5ccc(CC)cc5)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)N(c4ccc(CC)cc4)C(=O)[C@@H]23)ccc1O |
| InChI | InChI=1S/C38H38N2O6/c1-4-21-7-12-24(13-8-21)39-35(42)27-17-16-26-28(33(27)37(39)44)20-29-34(32(26)23-11-18-30(41)31(19-23)46-6-3)38(45)40(36(29)43)25-14-9-22(5-2)10-15-25/h7-16,18-19,27-29,32-34,41H,4-6,17,20H2,1-3H3/t27-,28+,29+,32-,33-,34+/m0/s1 |
| InChIKey | BJGJZLJYFXTNTD-CQABVSIHSA-N |
| XLogP | 5.96 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|