C36H33FN2O5 — CID 4125308
2,8-bis(4-ethylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4125308) has the molecular formula C36H33FN2O5 and a molecular weight of 592.67 g/mol. Its IUPAC name is 2,8-bis(4-ethylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-ethylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4125308 |
| Molecular Formula | C36H33FN2O5 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 2,8-bis(4-ethylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(c6ccc(CC)cc6)C(=O)C5C4c4ccc(O)c(F)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C36H33FN2O5/c1-3-19-5-10-22(11-6-19)38-33(41)25-15-14-24-26(31(25)35(38)43)18-27-32(30(24)21-9-16-29(40)28(37)17-21)36(44)39(34(27)42)23-12-7-20(4-2)8-13-23/h5-14,16-17,25-27,30-32,40H,3-4,15,18H2,1-2H3 |
| InChIKey | HYAKLBHKSAKEEE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|