C32H37FN2O5 — CID 3464257
2,8-dicyclohexyl-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3464257) has the molecular formula C32H37FN2O5 and a molecular weight of 548.66 g/mol. Its IUPAC name is 2,8-dicyclohexyl-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-dicyclohexyl-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3464257 |
| Molecular Formula | C32H37FN2O5 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 2,8-dicyclohexyl-6-(3-fluoro-4-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(C5CCCCC5)C(=O)C4C3c3ccc(O)c(F)c3)C2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C32H37FN2O5/c33-24-15-17(11-14-25(24)36)26-20-12-13-21-27(31(39)34(29(21)37)18-7-3-1-4-8-18)22(20)16-23-28(26)32(40)35(30(23)38)19-9-5-2-6-10-19/h11-12,14-15,18-19,21-23,26-28,36H,1-10,13,16H2 |
| InChIKey | WUNZFBHHMZUHMJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|