C36H26Cl2N2O5 — CID 6639164
(3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-chlorophenyl)-6-(1-hydroxynaphthalen-2-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6639164) has the molecular formula C36H26Cl2N2O5 and a molecular weight of 637.52 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-chlorophenyl)-6-(1-hydroxynaphthalen-2-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-chlorophenyl)-6-(1-hydroxynaphthalen-2-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6639164 |
| Molecular Formula | C36H26Cl2N2O5 |
| Molecular Weight | 637.52 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-chlorophenyl)-6-(1-hydroxynaphthalen-2-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)N(c4ccc(Cl)cc4)C(=O)[C@H]2[C@H]3c2ccc3ccccc3c2O)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H26Cl2N2O5/c37-19-6-10-21(11-7-19)39-33(42)26-16-15-24-27(30(26)35(39)44)17-28-31(36(45)40(34(28)43)22-12-8-20(38)9-13-22)29(24)25-14-5-18-3-1-2-4-23(18)32(25)41/h1-15,26-31,41H,16-17H2/t26-,27+,28+,29+,30-,31+/m0/s1 |
| InChIKey | IHKWAGWXCHEGFM-PPGFEIEBSA-N |
| XLogP | 6.90 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|