C30H38N2O6 — CID 4088949
2,8-ditert-butyl-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4088949) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is 2,8-ditert-butyl-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-ditert-butyl-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4088949 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2,8-ditert-butyl-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC(C)(C)N1C(=O)C2CC=C3C(CC4C(=O)N(C(C)(C)C)C(=O)C4C3c3ccccc3OCCO)C2C1=O |
| InChI | InChI=1S/C30H38N2O6/c1-29(2,3)31-25(34)18-12-11-16-19(23(18)27(31)36)15-20-24(28(37)32(26(20)35)30(4,5)6)22(16)17-9-7-8-10-21(17)38-14-13-33/h7-11,18-20,22-24,33H,12-15H2,1-6H3 |
| InChIKey | CEPMGUSPRJESLF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|