C29H36N2O6 — CID 4639740
2,8-ditert-butyl-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4639740) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2,8-ditert-butyl-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-ditert-butyl-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4639740 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2,8-ditert-butyl-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(O)c(C2C3=CCC4C(=O)N(C(C)(C)C)C(=O)C4C3CC3C(=O)N(C(C)(C)C)C(=O)C32)c1 |
| InChI | InChI=1S/C29H36N2O6/c1-28(2,3)30-24(33)16-10-9-15-17(22(16)26(30)35)13-19-23(27(36)31(25(19)34)29(4,5)6)21(15)18-12-14(37-7)8-11-20(18)32/h8-9,11-12,16-17,19,21-23,32H,10,13H2,1-7H3 |
| InChIKey | IRDLJTNOQCWJNP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|