C26H29NO5 — CID 162922318
(11S,12S,13S,14R)-13,15,15-trimethyl-12-(3,4,5-trimethoxyphenyl)-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 162922318) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is (11S,12S,13S,14R)-13,15,15-trimethyl-12-(3,4,5-trimethoxyphenyl)-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | (11S,12S,13S,14R)-13,15,15-trimethyl-12-(3,4,5-trimethoxyphenyl)-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 162922318 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (11S,12S,13S,14R)-13,15,15-trimethyl-12-(3,4,5-trimethoxyphenyl)-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | COc1cc([C@H]2[C@H](C)[C@@H]3[C@H]2c2c(c4ccccc4[nH]c2=O)OC3(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C26H29NO5/c1-13-19(14-11-17(29-4)24(31-6)18(12-14)30-5)20-21-23(32-26(2,3)22(13)20)15-9-7-8-10-16(15)27-25(21)28/h7-13,19-20,22H,1-6H3,(H,27,28)/t13-,19+,20+,22+/m0/s1 |
| InChIKey | JTYASLGJTZDIAO-OETIHYEZSA-N |
| XLogP | 4.86 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |