C15H17NO3 — CID 71324136
3-[(3,3-dimethyloxiran-2-yl)methyl]-4-methoxy-1H-quinolin-2-one (PubChem CID 71324136) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[(3,3-dimethyloxiran-2-yl)methyl]-4-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[(3,3-dimethyloxiran-2-yl)methyl]-4-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 71324136 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-[(3,3-dimethyloxiran-2-yl)methyl]-4-methoxy-1H-quinolin-2-one |
| SMILES | COc1c(CC2OC2(C)C)c(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17NO3/c1-15(2)12(19-15)8-10-13(18-3)9-6-4-5-7-11(9)16-14(10)17/h4-7,12H,8H2,1-3H3,(H,16,17) |
| InChIKey | LYGMWXVYIDHBIT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|