C18H23NO2 — CID 162850257
(E)-4-[3-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indol-2-yl]-2-methylbut-3-en-2-ol (PubChem CID 162850257) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (E)-4-[3-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indol-2-yl]-2-methylbut-3-en-2-ol.
| Compound Name | (E)-4-[3-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indol-2-yl]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 162850257 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (E)-4-[3-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-1H-indol-2-yl]-2-methylbut-3-en-2-ol |
| SMILES | CC(C)(O)/C=C/c1[nH]c2ccccc2c1C[C@H]1OC1(C)C |
| InChI | InChI=1S/C18H23NO2/c1-17(2,20)10-9-15-13(11-16-18(3,4)21-16)12-7-5-6-8-14(12)19-15/h5-10,16,19-20H,11H2,1-4H3/b10-9+/t16-/m1/s1 |
| InChIKey | VUPGYGJDPXEHAE-ZNFPLGDCSA-N |
| XLogP | 3.67 |
| TPSA | 48.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|