C16H20N2O2 — CID 11448669
(2S)-2-amino-3-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]propanoic acid (PubChem CID 11448669) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11448669 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2S)-2-amino-3-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]propanoic acid |
| SMILES | C=CC(C)(C)c1[nH]c2ccccc2c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H20N2O2/c1-4-16(2,3)14-11(9-12(17)15(19)20)10-7-5-6-8-13(10)18-14/h4-8,12,18H,1,9,17H2,2-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | XOWJLZPKXHOSPF-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|