C16H19N3O5 — CID 67457863
(4R)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]-1H-indol-2-yl]-5-oxopentanoic acid (PubChem CID 67457863) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is (4R)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]-1H-indol-2-yl]-5-oxopentanoic acid.
| Compound Name | (4R)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]-1H-indol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67457863 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (4R)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]-1H-indol-2-yl]-5-oxopentanoic acid |
| SMILES | N[C@H](Cc1c(C(=O)[C@H](N)CCC(=O)O)[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H19N3O5/c17-10(5-6-13(20)21)15(22)14-9(7-11(18)16(23)24)8-3-1-2-4-12(8)19-14/h1-4,10-11,19H,5-7,17-18H2,(H,20,21)(H,23,24)/t10-,11-/m1/s1 |
| InChIKey | ZLJRUGQYYQEVJB-GHMZBOCLSA-N |
| XLogP | 0.50 |
| TPSA | 159.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|