C22H35N7O8 — CID 175567301
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-(1H-indol-3-yl)propanoic acid;2-aminopentanedioic acid (PubChem CID 175567301) has the molecular formula C22H35N7O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-(1H-indol-3-yl)propanoic acid;2-aminopentanedioic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-(1H-indol-3-yl)propanoic acid;2-aminopentanedioic acid |
|---|---|
| PubChem CID | 175567301 |
| Molecular Formula | C22H35N7O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-(1H-indol-3-yl)propanoic acid;2-aminopentanedioic acid |
| SMILES | NC(CCC(=O)O)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C11H12N2O2.C6H14N4O2.C5H9NO4/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;7-4(5(11)12)2-1-3-10-6(8)9;6-3(5(9)10)1-2-4(7)8/h1-4,6,9,13H,5,12H2,(H,14,15);4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | CYKXNJYHGNKZFN-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 307.45 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|