C24H20N2O3S — CID 7095499
(2R,12R)-6,7-dimethoxy-12-thiophen-2-yl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one (PubChem CID 7095499) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is (2R,12R)-6,7-dimethoxy-12-thiophen-2-yl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one.
| Compound Name | (2R,12R)-6,7-dimethoxy-12-thiophen-2-yl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one |
|---|---|
| PubChem CID | 7095499 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2R,12R)-6,7-dimethoxy-12-thiophen-2-yl-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one |
| SMILES | COc1ccc2c(c1OC)C(=O)N1C[C@H](c3cccs3)c3c([nH]c4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C24H20N2O3S/c1-28-17-10-9-14-20(23(17)29-2)24(27)26-12-15(18-8-5-11-30-18)19-13-6-3-4-7-16(13)25-21(19)22(14)26/h3-11,15,22,25H,12H2,1-2H3/t15-,22-/m1/s1 |
| InChIKey | MBTYOUHHAPXLTE-IVZQSRNASA-N |
| XLogP | 4.94 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|