C13H16O — CID 177435571
(3Z)-3-benzylidene-2,2-dimethyloxolane (PubChem CID 177435571) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (3Z)-3-benzylidene-2,2-dimethyloxolane.
| Compound Name | (3Z)-3-benzylidene-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 177435571 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (3Z)-3-benzylidene-2,2-dimethyloxolane |
| SMILES | CC1(C)OCC/C1=C/c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-13(2)12(8-9-14-13)10-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3/b12-10- |
| InChIKey | BKUVBOLTXIRWOR-BENRWUELSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |