C18H24O2 — CID 177493543
cis-(1R,3R,4Z)-4-benzylidene-3-but-3-enyl-1-methylcyclohexane-1,3-diol (PubChem CID 177493543) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is cis-(1R,3R,4Z)-4-benzylidene-3-but-3-enyl-1-methylcyclohexane-1,3-diol.
| Compound Name | cis-(1R,3R,4Z)-4-benzylidene-3-but-3-enyl-1-methylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 177493543 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | cis-(1R,3R,4Z)-4-benzylidene-3-but-3-enyl-1-methylcyclohexane-1,3-diol |
| SMILES | C=CCC[C@@]1(O)C[C@](C)(O)CC/C1=C/c1ccccc1 |
| InChI | InChI=1S/C18H24O2/c1-3-4-11-18(20)14-17(2,19)12-10-16(18)13-15-8-6-5-7-9-15/h3,5-9,13,19-20H,1,4,10-12,14H2,2H3/b16-13-/t17-,18-/m1/s1 |
| InChIKey | IDFYQTMBDRVNLB-CRKJHWTRSA-N |
| XLogP | 3.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|