C19H21N — CID 139263960
(2R,3R)-2-but-3-enyl-2-methyl-1,3-diphenylaziridine (PubChem CID 139263960) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is (2R,3R)-2-but-3-enyl-2-methyl-1,3-diphenylaziridine.
| Compound Name | (2R,3R)-2-but-3-enyl-2-methyl-1,3-diphenylaziridine |
|---|---|
| PubChem CID | 139263960 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (2R,3R)-2-but-3-enyl-2-methyl-1,3-diphenylaziridine |
| SMILES | C=CCC[C@]1(C)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C19H21N/c1-3-4-15-19(2)18(16-11-7-5-8-12-16)20(19)17-13-9-6-10-14-17/h3,5-14,18H,1,4,15H2,2H3/t18-,19-,20?/m1/s1 |
| InChIKey | ATIHAPFVBRNPBV-LEAGNCFPSA-N |
| XLogP | 4.97 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|