C17H17N — CID 102111055
(2R,3R)-3-ethenyl-1,2-diphenylazetidine (PubChem CID 102111055) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is (2R,3R)-3-ethenyl-1,2-diphenylazetidine.
| Compound Name | (2R,3R)-3-ethenyl-1,2-diphenylazetidine |
|---|---|
| PubChem CID | 102111055 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2R,3R)-3-ethenyl-1,2-diphenylazetidine |
| SMILES | C=C[C@@H]1CN(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17N/c1-2-14-13-18(16-11-7-4-8-12-16)17(14)15-9-5-3-6-10-15/h2-12,14,17H,1,13H2/t14-,17-/m1/s1 |
| InChIKey | LUKNZOLFSYJYII-RHSMWYFYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|