C17H17NS — CID 91057103
(3S)-1-phenyl-3-prop-2-enyl-3,4-dihydro-2,1-benzothiazine (PubChem CID 91057103) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is (3S)-1-phenyl-3-prop-2-enyl-3,4-dihydro-2,1-benzothiazine.
| Compound Name | (3S)-1-phenyl-3-prop-2-enyl-3,4-dihydro-2,1-benzothiazine |
|---|---|
| PubChem CID | 91057103 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3S)-1-phenyl-3-prop-2-enyl-3,4-dihydro-2,1-benzothiazine |
| SMILES | C=CC[C@H]1Cc2ccccc2N(c2ccccc2)S1 |
| InChI | InChI=1S/C17H17NS/c1-2-8-16-13-14-9-6-7-12-17(14)18(19-16)15-10-4-3-5-11-15/h2-7,9-12,16H,1,8,13H2/t16-/m0/s1 |
| InChIKey | SOTLYPANFSBMBI-INIZCTEOSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|